C16H24N2O6 — CID 136746748
2,5-bis[(1,3-dihydroxy-2-methylpropan-2-yl)iminomethyl]benzene-1,4-diol (PubChem CID 136746748) has the molecular formula C16H24N2O6 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2,5-bis[(1,3-dihydroxy-2-methylpropan-2-yl)iminomethyl]benzene-1,4-diol.
| Compound Name | 2,5-bis[(1,3-dihydroxy-2-methylpropan-2-yl)iminomethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 136746748 |
| Molecular Formula | C16H24N2O6 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2,5-bis[(1,3-dihydroxy-2-methylpropan-2-yl)iminomethyl]benzene-1,4-diol |
| SMILES | CC(CO)(CO)/N=C/c1cc(O)c(/C=N/C(C)(CO)CO)cc1O |
| InChI | InChI=1S/C16H24N2O6/c1-15(7-19,8-20)17-5-11-3-14(24)12(4-13(11)23)6-18-16(2,9-21)10-22/h3-6,19-24H,7-10H2,1-2H3/b17-5+,18-6+ |
| InChIKey | IIZLOLIXTJFBRG-QJZPKIEXSA-N |
| XLogP | -0.58 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|