C18H20N4O6 — CID 166987229
5-[(E)-[[2-methyl-1-[(2E)-2-[(2,4,5-trihydroxyphenyl)methylidene]hydrazinyl]prop-1-enyl]hydrazinylidene]methyl]benzene-1,2,4-triol (PubChem CID 166987229) has the molecular formula C18H20N4O6 and a molecular weight of 388.38 g/mol. Its IUPAC name is 5-[(E)-[[2-methyl-1-[(2E)-2-[(2,4,5-trihydroxyphenyl)methylidene]hydrazinyl]prop-1-enyl]hydrazinylidene]methyl]benzene-1,2,4-triol.
| Compound Name | 5-[(E)-[[2-methyl-1-[(2E)-2-[(2,4,5-trihydroxyphenyl)methylidene]hydrazinyl]prop-1-enyl]hydrazinylidene]methyl]benzene-1,2,4-triol |
|---|---|
| PubChem CID | 166987229 |
| Molecular Formula | C18H20N4O6 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 5-[(E)-[[2-methyl-1-[(2E)-2-[(2,4,5-trihydroxyphenyl)methylidene]hydrazinyl]prop-1-enyl]hydrazinylidene]methyl]benzene-1,2,4-triol |
| SMILES | CC(C)=C(N/N=C/c1cc(O)c(O)cc1O)N/N=C/c1cc(O)c(O)cc1O |
| InChI | InChI=1S/C18H20N4O6/c1-9(2)18(21-19-7-10-3-14(25)16(27)5-12(10)23)22-20-8-11-4-15(26)17(28)6-13(11)24/h3-8,21-28H,1-2H3/b19-7+,20-8+ |
| InChIKey | ADNYTABRVQDDPO-OKXCLTPOSA-N |
| XLogP | 1.72 |
| TPSA | 170.16 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|