About CID 136756069
CID 136756069 (PubChem CID 136756069) has the molecular formula C19H42B2P2
and a molecular weight of 354.12 g/mol.
Molecular Properties
| Compound Name | CID 136756069 |
| PubChem CID | 136756069 |
| Molecular Formula | C19H42B2P2 |
| Molecular Weight | 354.12 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | — |
| SMILES | [B-][P+](C)(C[P+]([B-])(C)C(C)(C)CC(C)(C)C)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C19H42B2P2/c1-16(2,3)13-18(7,8)22(11,20)15-23(12,21)19(9,10)14-17(4,5)6/h13-15H2,1-12H3 |
| InChIKey | KVXHGIIOHHFTGX-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.12 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 136756069 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136756069?
The IUPAC name of CID 136756069 (CID 136756069) is not available.
What is the SMILES notation for CID 136756069?
The canonical SMILES for CID 136756069 is [B-][P+](C)(C[P+]([B-])(C)C(C)(C)CC(C)(C)C)C(C)(C)CC(C)(C)C.
What is the InChIKey of CID 136756069?
The InChIKey is KVXHGIIOHHFTGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H42B2P2/c1-16(2,3)13-18(7,8)22(11,20)15-23(12,21)19(9,10)14-17(4,5)6/h13-15H2,1-12H3.
What are the key properties of CID 136756069?
CID 136756069 has a molecular weight of 354.12 g/mol, XLogP of 6.84, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136756069 is sourced from PubChem (CID 136756069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).