C17H11NO3S — CID 136756878
(15E)-15-(1-hydroxyethylidene)-8-thia-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaene-14,16-dione (PubChem CID 136756878) has the molecular formula C17H11NO3S and a molecular weight of 309.35 g/mol. Its IUPAC name is (15E)-15-(1-hydroxyethylidene)-8-thia-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaene-14,16-dione.
| Compound Name | (15E)-15-(1-hydroxyethylidene)-8-thia-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaene-14,16-dione |
|---|---|
| PubChem CID | 136756878 |
| Molecular Formula | C17H11NO3S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | (15E)-15-(1-hydroxyethylidene)-8-thia-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaene-14,16-dione |
| SMILES | C/C(O)=c1/c(=O)c2cccc3sc4ccccc4n(c1=O)-c32 |
| InChI | InChI=1S/C17H11NO3S/c1-9(19)14-16(20)10-5-4-8-13-15(10)18(17(14)21)11-6-2-3-7-12(11)22-13/h2-8,19H,1H3/b14-9+ |
| InChIKey | CWRXMTIOSQJJGA-NTEUORMPSA-N |
| XLogP | 2.41 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|