C19H8F7NO4 — CID 177066223
15-(2,2,3,3,4,4,4-heptafluoro-1-hydroxybutylidene)-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaene-14,16-dione (PubChem CID 177066223) has the molecular formula C19H8F7NO4 and a molecular weight of 447.26 g/mol. Its IUPAC name is 15-(2,2,3,3,4,4,4-heptafluoro-1-hydroxybutylidene)-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaene-14,16-dione.
| Compound Name | 15-(2,2,3,3,4,4,4-heptafluoro-1-hydroxybutylidene)-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaene-14,16-dione |
|---|---|
| PubChem CID | 177066223 |
| Molecular Formula | C19H8F7NO4 |
| Molecular Weight | 447.26 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 15-(2,2,3,3,4,4,4-heptafluoro-1-hydroxybutylidene)-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaene-14,16-dione |
| SMILES | O=c1c(=C(O)C(F)(F)C(F)(F)C(F)(F)F)c(=O)n2c3ccccc3oc3cccc1c3-2 |
| InChI | InChI=1S/C19H8F7NO4/c20-17(21,18(22,23)19(24,25)26)15(29)12-14(28)8-4-3-7-11-13(8)27(16(12)30)9-5-1-2-6-10(9)31-11/h1-7,29H |
| InChIKey | OYRVFOOGFKPCFB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|