About CID 136763086
CID 136763086 (PubChem CID 136763086) has the molecular formula C14H16B
and a molecular weight of 195.09 g/mol.
Molecular Properties
| Compound Name | CID 136763086 |
| PubChem CID | 136763086 |
| Molecular Formula | C14H16B |
| Molecular Weight | 195.09 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | — |
| SMILES | [B]1C[C@H]2C=C(c3ccccc3)C[C@@H](C1)C2 |
| InChI | InChI=1S/C14H16B/c1-2-4-13(5-3-1)14-7-11-6-12(8-14)10-15-9-11/h1-5,7,11-12H,6,8-10H2/t11-,12+/m1/s1 |
| InChIKey | WHGKTCFVHAFLJI-NEPJUHHUSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.09 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136763086 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136763086?
The IUPAC name of CID 136763086 (CID 136763086) is not available.
What is the SMILES notation for CID 136763086?
The canonical SMILES for CID 136763086 is [B]1C[C@H]2C=C(c3ccccc3)C[C@@H](C1)C2.
What is the InChIKey of CID 136763086?
The InChIKey is WHGKTCFVHAFLJI-NEPJUHHUSA-N. The full InChI is InChI=1S/C14H16B/c1-2-4-13(5-3-1)14-7-11-6-12(8-14)10-15-9-11/h1-5,7,11-12H,6,8-10H2/t11-,12+/m1/s1.
What are the key properties of CID 136763086?
CID 136763086 has a molecular weight of 195.09 g/mol, XLogP of 3.65, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136763086 is sourced from PubChem (CID 136763086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).