C37H53O8Si4 — CID 136778095
CID 136778095 (PubChem CID 136778095) has the molecular formula C37H53O8Si4 and a molecular weight of 738.17 g/mol.
| Compound Name | CID 136778095 |
|---|---|
| PubChem CID | 136778095 |
| Molecular Formula | C37H53O8Si4 |
| Molecular Weight | 738.17 g/mol |
| Exact Mass | 737.28 |
| IUPAC Name | — |
| SMILES | CCC(C)COc1ccc(OC(=O)c2ccc(-c3ccc(OCCCCCCCCC[Si]4(C)O[Si](C)O[Si](C)O[Si](C)O4)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H53O8Si4/c1-7-30(2)29-40-35-23-25-36(26-24-35)41-37(38)33-17-15-31(16-18-33)32-19-21-34(22-20-32)39-27-13-11-9-8-10-12-14-28-49(6)44-47(4)42-46(3)43-48(5)45-49/h15-26,30H,7-14,27-29H2,1-6H3 |
| InChIKey | JBELWLZYYJQTHI-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.17 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|