C40H59O8Si4 — CID 136778098
CID 136778098 (PubChem CID 136778098) has the molecular formula C40H59O8Si4 and a molecular weight of 780.25 g/mol.
| Compound Name | CID 136778098 |
|---|---|
| PubChem CID | 136778098 |
| Molecular Formula | C40H59O8Si4 |
| Molecular Weight | 780.25 g/mol |
| Exact Mass | 779.33 |
| IUPAC Name | — |
| SMILES | CCCCCCC(C)Oc1ccc(OC(=O)c2ccc(-c3ccc(OCCCCCCCCC[Si]4(C)O[Si](C)O[Si](C)O[Si](C)O4)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H59O8Si4/c1-7-8-9-15-18-33(2)43-38-27-29-39(30-28-38)44-40(41)36-21-19-34(20-22-36)35-23-25-37(26-24-35)42-31-16-13-11-10-12-14-17-32-52(6)47-50(4)45-49(3)46-51(5)48-52/h19-30,33H,7-18,31-32H2,1-6H3 |
| InChIKey | BGDYWTPBAYXOPW-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.25 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|