C14H17FN4O2 — CID 136779960
6-[(4-fluorophenyl)methyl]-3-(3-methoxypropylamino)-4H-1,2,4-triazin-5-one (PubChem CID 136779960) has the molecular formula C14H17FN4O2 and a molecular weight of 292.31 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methyl]-3-(3-methoxypropylamino)-4H-1,2,4-triazin-5-one.
| Compound Name | 6-[(4-fluorophenyl)methyl]-3-(3-methoxypropylamino)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136779960 |
| Molecular Formula | C14H17FN4O2 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 6-[(4-fluorophenyl)methyl]-3-(3-methoxypropylamino)-4H-1,2,4-triazin-5-one |
| SMILES | COCCCNc1nnc(Cc2ccc(F)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H17FN4O2/c1-21-8-2-7-16-14-17-13(20)12(18-19-14)9-10-3-5-11(15)6-4-10/h3-6H,2,7-9H2,1H3,(H2,16,17,19,20) |
| InChIKey | HIRWQQUPYOPURQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|