C33H46O3Si2 — CID 136784462
CID 136784462 (PubChem CID 136784462) has the molecular formula C33H46O3Si2 and a molecular weight of 546.90 g/mol.
| Compound Name | CID 136784462 |
|---|---|
| PubChem CID | 136784462 |
| Molecular Formula | C33H46O3Si2 |
| Molecular Weight | 546.90 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | — |
| SMILES | CC[Si](CC)C1=C2CC(COCc3ccccc3)(COCc3ccccc3)CC2=C([Si](CC)CC)C1(C)O |
| InChI | InChI=1S/C33H46O3Si2/c1-6-37(7-2)30-28-20-33(24-35-22-26-16-12-10-13-17-26,25-36-23-27-18-14-11-15-19-27)21-29(28)31(32(30,5)34)38(8-3)9-4/h10-19,34H,6-9,20-25H2,1-5H3 |
| InChIKey | VPCZUQSSXXIXLU-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.90 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|