C40H60N2O2 — CID 136791974
2,4-ditert-butyl-6-[[(1R,2S,5S)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyliminomethyl]phenol (PubChem CID 136791974) has the molecular formula C40H60N2O2 and a molecular weight of 600.93 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[(1R,2S,5S)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyliminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[(1R,2S,5S)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyliminomethyl]phenol |
|---|---|
| PubChem CID | 136791974 |
| Molecular Formula | C40H60N2O2 |
| Molecular Weight | 600.93 g/mol |
| Exact Mass | 600.47 |
| IUPAC Name | 2,4-ditert-butyl-6-[[(1R,2S,5S)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyliminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N\C[C@]2(/N=C/c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)CC[C@H]3C[C@@H]2C3(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C40H60N2O2/c1-35(2,3)28-17-25(33(43)30(19-28)37(7,8)9)22-41-24-40(16-15-27-21-32(40)39(27,13)14)42-23-26-18-29(36(4,5)6)20-31(34(26)44)38(10,11)12/h17-20,22-23,27,32,43-44H,15-16,21,24H2,1-14H3/b41-22-,42-23+/t27-,32+,40+/m0/s1 |
| InChIKey | QZTYCWKZYGAQHI-RORBOCHASA-N |
| XLogP | 10.02 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.93 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|