C28H26N2O6 — CID 136798602
(1E,6E)-5-hydroxy-1,7-bis(4-hydroxy-3-methoxyphenyl)-4-[(4-methylphenyl)diazenyl]hepta-1,4,6-trien-3-one (PubChem CID 136798602) has the molecular formula C28H26N2O6 and a molecular weight of 486.52 g/mol. Its IUPAC name is (1E,6E)-5-hydroxy-1,7-bis(4-hydroxy-3-methoxyphenyl)-4-[(4-methylphenyl)diazenyl]hepta-1,4,6-trien-3-one.
| Compound Name | (1E,6E)-5-hydroxy-1,7-bis(4-hydroxy-3-methoxyphenyl)-4-[(4-methylphenyl)diazenyl]hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 136798602 |
| Molecular Formula | C28H26N2O6 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | (1E,6E)-5-hydroxy-1,7-bis(4-hydroxy-3-methoxyphenyl)-4-[(4-methylphenyl)diazenyl]hepta-1,4,6-trien-3-one |
| SMILES | COc1cc(/C=C/C(=O)C(/N=N/c2ccc(C)cc2)=C(O)/C=C/c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C28H26N2O6/c1-18-4-10-21(11-5-18)29-30-28(24(33)14-8-19-6-12-22(31)26(16-19)35-2)25(34)15-9-20-7-13-23(32)27(17-20)36-3/h4-17,31-33H,1-3H3/b14-8+,15-9+,28-24?,30-29+ |
| InChIKey | YAQHWIPWEZJRDA-DBPOBQMMSA-N |
| XLogP | 6.27 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|