C17H16BrN3O4S2 — CID 136802312
3-[(2E)-2-[(Z)-(5-bromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid (PubChem CID 136802312) has the molecular formula C17H16BrN3O4S2 and a molecular weight of 470.37 g/mol. Its IUPAC name is 3-[(2E)-2-[(Z)-(5-bromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2E)-2-[(Z)-(5-bromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 136802312 |
| Molecular Formula | C17H16BrN3O4S2 |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 468.98 |
| IUPAC Name | 3-[(2E)-2-[(Z)-(5-bromo-2-hydroxyphenyl)methylidenehydrazinylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCn1/c(=N\N=C/c2cc(Br)ccc2O)sc2ccccc21 |
| InChI | InChI=1S/C17H16BrN3O4S2/c18-13-6-7-15(22)12(10-13)11-19-20-17-21(8-3-9-27(23,24)25)14-4-1-2-5-16(14)26-17/h1-2,4-7,10-11,22H,3,8-9H2,(H,23,24,25)/b19-11-,20-17+ |
| InChIKey | IJJRXLJPSOGMCD-ZFISKCCJSA-N |
| XLogP | 3.38 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|