C66H74N4 — CID 136807996
5,10,15-tris(3,5-ditert-butylphenyl)-2,18-diethynyl-21,23-dihydroporphyrin (PubChem CID 136807996) has the molecular formula C66H74N4 and a molecular weight of 923.35 g/mol. Its IUPAC name is 5,10,15-tris(3,5-ditert-butylphenyl)-2,18-diethynyl-21,23-dihydroporphyrin.
| Compound Name | 5,10,15-tris(3,5-ditert-butylphenyl)-2,18-diethynyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136807996 |
| Molecular Formula | C66H74N4 |
| Molecular Weight | 923.35 g/mol |
| Exact Mass | 922.59 |
| IUPAC Name | 5,10,15-tris(3,5-ditert-butylphenyl)-2,18-diethynyl-21,23-dihydroporphyrin |
| SMILES | C#CC1=Cc2nc1cc1[nH]c(cc1C#C)c(-c1cc(C(C)(C)C)cc(C(C)(C)C)c1)c1nc(c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c3ccc([nH]3)c2-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)C=C1 |
| InChI | InChI=1S/C66H74N4/c1-21-39-33-56-59(42-29-46(63(9,10)11)36-47(30-42)64(12,13)14)52-25-23-50(67-52)58(41-27-44(61(3,4)5)35-45(28-41)62(6,7)8)51-24-26-53(68-51)60(57-34-40(22-2)55(70-57)38-54(39)69-56)43-31-48(65(15,16)17)37-49(32-43)66(18,19)20/h1-2,23-38,67,70H,3-20H3/b54-38-,55-38-,58-50-,58-51-,59-52-,59-56-,60-53-,60-57- |
| InChIKey | OQHHGTHJCAMLDD-ONZAQCSKSA-N |
| XLogP | 17.43 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.35 |
| LogP ≤ 5 | 17.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|