C50H39N3 — CID 136812087
20-tert-butyl-2,7,12,17-tetraphenyl-23,24,25-triazapentacyclo[16.3.1.13,6.18,11.113,16]pentacosa-1(22),2,4,6(25),7,9,11,13(23),14,16,18,20-dodecaene (PubChem CID 136812087) has the molecular formula C50H39N3 and a molecular weight of 681.88 g/mol. Its IUPAC name is 20-tert-butyl-2,7,12,17-tetraphenyl-23,24,25-triazapentacyclo[16.3.1.13,6.18,11.113,16]pentacosa-1(22),2,4,6(25),7,9,11,13(23),14,16,18,20-dodecaene.
| Compound Name | 20-tert-butyl-2,7,12,17-tetraphenyl-23,24,25-triazapentacyclo[16.3.1.13,6.18,11.113,16]pentacosa-1(22),2,4,6(25),7,9,11,13(23),14,16,18,20-dodecaene |
|---|---|
| PubChem CID | 136812087 |
| Molecular Formula | C50H39N3 |
| Molecular Weight | 681.88 g/mol |
| Exact Mass | 681.31 |
| IUPAC Name | 20-tert-butyl-2,7,12,17-tetraphenyl-23,24,25-triazapentacyclo[16.3.1.13,6.18,11.113,16]pentacosa-1(22),2,4,6(25),7,9,11,13(23),14,16,18,20-dodecaene |
| SMILES | CC(C)(C)c1cc2cc(c1)/C(c1ccccc1)=C1/C=CC(=N1)/C(c1ccccc1)=c1\cc/c([nH]1)=C(/c1ccccc1)C1=N/C(=C\2c2ccccc2)C=C1 |
| InChI | InChI=1S/C50H39N3/c1-50(2,3)39-31-37-30-38(32-39)47(34-18-10-5-11-19-34)41-25-27-43(52-41)49(36-22-14-7-15-23-36)45-29-28-44(53-45)48(35-20-12-6-13-21-35)42-26-24-40(51-42)46(37)33-16-8-4-9-17-33/h4-32,53H,1-3H3/b46-40-,47-41-,48-44+,49-45+ |
| InChIKey | VKTJXKKMPLTCEB-ANIFHTTJSA-N |
| XLogP | 9.96 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.88 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |