C48H38Cl4N8O8S4 — CID 136814599
4-chloro-N-methyl-3-[10,15,20-tris[2-chloro-5-(methylsulfamoyl)phenyl]-21,23-dihydroporphyrin-5-yl]benzenesulfonamide (PubChem CID 136814599) has the molecular formula C48H38Cl4N8O8S4 and a molecular weight of 1124.96 g/mol. Its IUPAC name is 4-chloro-N-methyl-3-[10,15,20-tris[2-chloro-5-(methylsulfamoyl)phenyl]-21,23-dihydroporphyrin-5-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-methyl-3-[10,15,20-tris[2-chloro-5-(methylsulfamoyl)phenyl]-21,23-dihydroporphyrin-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 136814599 |
| Molecular Formula | C48H38Cl4N8O8S4 |
| Molecular Weight | 1124.96 g/mol |
| Exact Mass | 1122.04 |
| IUPAC Name | 4-chloro-N-methyl-3-[10,15,20-tris[2-chloro-5-(methylsulfamoyl)phenyl]-21,23-dihydroporphyrin-5-yl]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(Cl)c(-c2c3nc(c(-c4cc(S(=O)(=O)NC)ccc4Cl)c4ccc([nH]4)c(-c4cc(S(=O)(=O)NC)ccc4Cl)c4nc(c(-c5cc(S(=O)(=O)NC)ccc5Cl)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C48H38Cl4N8O8S4/c1-53-69(61,62)25-5-9-33(49)29(21-25)45-37-13-15-39(57-37)46(30-22-26(6-10-34(30)50)70(63,64)54-2)41-17-19-43(59-41)48(32-24-28(8-12-36(32)52)72(67,68)56-4)44-20-18-42(60-44)47(40-16-14-38(45)58-40)31-23-27(7-11-35(31)51)71(65,66)55-3/h5-24,53-57,60H,1-4H3/b45-37-,45-38-,46-39-,46-41-,47-40-,47-42-,48-43-,48-44- |
| InChIKey | VMHPMNFDTXDFEI-PJEPRTEXSA-N |
| XLogP | 9.57 |
| TPSA | 242.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1124.96 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |