C13H12N4O3S — CID 136819042
2-[[(2R)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]imino]-1,3-diazinane-4,6-dione (PubChem CID 136819042) has the molecular formula C13H12N4O3S and a molecular weight of 304.33 g/mol. Its IUPAC name is 2-[[(2R)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]imino]-1,3-diazinane-4,6-dione.
| Compound Name | 2-[[(2R)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]imino]-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 136819042 |
| Molecular Formula | C13H12N4O3S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-[[(2R)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]imino]-1,3-diazinane-4,6-dione |
| SMILES | O=C1CC(=O)NC(=NN2C(=O)CS[C@@H]2c2ccccc2)N1 |
| InChI | InChI=1S/C13H12N4O3S/c18-9-6-10(19)15-13(14-9)16-17-11(20)7-21-12(17)8-4-2-1-3-5-8/h1-5,12H,6-7H2,(H2,14,15,16,18,19)/t12-/m1/s1 |
| InChIKey | BRFYTHSKZGPAPK-GFCCVEGCSA-N |
| XLogP | 0.17 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|