C14H16N2O4S2 — CID 136827372
(4aS,6R,7S,8S,8aS)-7,8-dihydroxy-6-(hydroxymethyl)-2-phenylimino-6,7,8,8a-tetrahydro-4aH-thiopyrano[2,3-e][1,3]thiazin-4-one (PubChem CID 136827372) has the molecular formula C14H16N2O4S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is (4aS,6R,7S,8S,8aS)-7,8-dihydroxy-6-(hydroxymethyl)-2-phenylimino-6,7,8,8a-tetrahydro-4aH-thiopyrano[2,3-e][1,3]thiazin-4-one.
| Compound Name | (4aS,6R,7S,8S,8aS)-7,8-dihydroxy-6-(hydroxymethyl)-2-phenylimino-6,7,8,8a-tetrahydro-4aH-thiopyrano[2,3-e][1,3]thiazin-4-one |
|---|---|
| PubChem CID | 136827372 |
| Molecular Formula | C14H16N2O4S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | (4aS,6R,7S,8S,8aS)-7,8-dihydroxy-6-(hydroxymethyl)-2-phenylimino-6,7,8,8a-tetrahydro-4aH-thiopyrano[2,3-e][1,3]thiazin-4-one |
| SMILES | O=C1N/C(=N/c2ccccc2)S[C@H]2[C@@H](O)[C@H](O)[C@@H](CO)S[C@@H]12 |
| InChI | InChI=1S/C14H16N2O4S2/c17-6-8-9(18)10(19)11-12(21-8)13(20)16-14(22-11)15-7-4-2-1-3-5-7/h1-5,8-12,17-19H,6H2,(H,15,16,20)/t8-,9-,10+,11+,12-/m1/s1 |
| InChIKey | FQTVFHUZBVMDRG-LDMBFOFVSA-N |
| XLogP | 0.10 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|