C8H12N2O5S — CID 102087139
(4aS,6R,7S,8R,8aR)-7,8-dihydroxy-6-(hydroxymethyl)-1,4a,6,7,8,8a-hexahydrothiopyrano[3,2-d]pyrimidine-2,4-dione (PubChem CID 102087139) has the molecular formula C8H12N2O5S and a molecular weight of 248.26 g/mol. Its IUPAC name is (4aS,6R,7S,8R,8aR)-7,8-dihydroxy-6-(hydroxymethyl)-1,4a,6,7,8,8a-hexahydrothiopyrano[3,2-d]pyrimidine-2,4-dione.
| Compound Name | (4aS,6R,7S,8R,8aR)-7,8-dihydroxy-6-(hydroxymethyl)-1,4a,6,7,8,8a-hexahydrothiopyrano[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102087139 |
| Molecular Formula | C8H12N2O5S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | (4aS,6R,7S,8R,8aR)-7,8-dihydroxy-6-(hydroxymethyl)-1,4a,6,7,8,8a-hexahydrothiopyrano[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@H]2S[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N1 |
| InChI | InChI=1S/C8H12N2O5S/c11-1-2-4(12)5(13)3-6(16-2)7(14)10-8(15)9-3/h2-6,11-13H,1H2,(H2,9,10,14,15)/t2-,3-,4-,5-,6+/m1/s1 |
| InChIKey | BSOGADFEVUWSLY-UKFBFLRUSA-N |
| XLogP | -2.61 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |