C8H13N3O4S — CID 102295863
(7S,8R)-2-amino-7,8-dihydroxy-6-(hydroxymethyl)-3,4a,6,7,8,8a-hexahydrothiopyrano[3,2-d]pyrimidin-4-one (PubChem CID 102295863) has the molecular formula C8H13N3O4S and a molecular weight of 247.28 g/mol. Its IUPAC name is (7S,8R)-2-amino-7,8-dihydroxy-6-(hydroxymethyl)-3,4a,6,7,8,8a-hexahydrothiopyrano[3,2-d]pyrimidin-4-one.
| Compound Name | (7S,8R)-2-amino-7,8-dihydroxy-6-(hydroxymethyl)-3,4a,6,7,8,8a-hexahydrothiopyrano[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 102295863 |
| Molecular Formula | C8H13N3O4S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | (7S,8R)-2-amino-7,8-dihydroxy-6-(hydroxymethyl)-3,4a,6,7,8,8a-hexahydrothiopyrano[3,2-d]pyrimidin-4-one |
| SMILES | NC1=NC2C(SC(CO)[C@@H](O)[C@@H]2O)C(=O)N1 |
| InChI | InChI=1S/C8H13N3O4S/c9-8-10-3-5(14)4(13)2(1-12)16-6(3)7(15)11-8/h2-6,12-14H,1H2,(H3,9,10,11,15)/t2?,3?,4-,5-,6?/m1/s1 |
| InChIKey | JOAGTYFSCMKHRN-BKAHITNQSA-N |
| XLogP | -3.00 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |