C10H13NO5S — CID 160572771
5-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]-1H-pyridine-2,4-dione (PubChem CID 160572771) has the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. Its IUPAC name is 5-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]-1H-pyridine-2,4-dione.
| Compound Name | 5-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]-1H-pyridine-2,4-dione |
|---|---|
| PubChem CID | 160572771 |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 5-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]-1H-pyridine-2,4-dione |
| SMILES | O=C1CC(=O)C(C2S[C@H](CO)[C@@H](O)[C@H]2O)=CN1 |
| InChI | InChI=1S/C10H13NO5S/c12-3-6-8(15)9(16)10(17-6)4-2-11-7(14)1-5(4)13/h2,6,8-10,12,15-16H,1,3H2,(H,11,14)/t6-,8-,9-,10?/m1/s1 |
| InChIKey | ZKYPKHGLPFGSDF-XIWVQZPPSA-N |
| XLogP | -1.84 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|