C7H11N3O3S — CID 130141388
2-ethoxy-3,3a,4,7a-tetrahydro-2H-[1,3]thiazolo[4,5-d]pyrimidine-5,7-dione (PubChem CID 130141388) has the molecular formula C7H11N3O3S and a molecular weight of 217.25 g/mol. Its IUPAC name is 2-ethoxy-3,3a,4,7a-tetrahydro-2H-[1,3]thiazolo[4,5-d]pyrimidine-5,7-dione.
| Compound Name | 2-ethoxy-3,3a,4,7a-tetrahydro-2H-[1,3]thiazolo[4,5-d]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 130141388 |
| Molecular Formula | C7H11N3O3S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 2-ethoxy-3,3a,4,7a-tetrahydro-2H-[1,3]thiazolo[4,5-d]pyrimidine-5,7-dione |
| SMILES | CCOC1NC2NC(=O)NC(=O)C2S1 |
| InChI | InChI=1S/C7H11N3O3S/c1-2-13-7-9-4-3(14-7)5(11)10-6(12)8-4/h3-4,7,9H,2H2,1H3,(H2,8,10,11,12) |
| InChIKey | WAIREFZOUBXNLX-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |