C23H25N3O7S — CID 139236975
(4aS,6R,7R,8S,8aR)-5-benzoyl-6-[(1R)-1,2-dihydroxyethyl]-7,8-dihydroxy-2-(4-methoxyphenyl)imino-6,7,8,8a-tetrahydro-4aH-pyrido[2,3-e][1,3]thiazin-4-one (PubChem CID 139236975) has the molecular formula C23H25N3O7S and a molecular weight of 487.53 g/mol. Its IUPAC name is (4aS,6R,7R,8S,8aR)-5-benzoyl-6-[(1R)-1,2-dihydroxyethyl]-7,8-dihydroxy-2-(4-methoxyphenyl)imino-6,7,8,8a-tetrahydro-4aH-pyrido[2,3-e][1,3]thiazin-4-one.
| Compound Name | (4aS,6R,7R,8S,8aR)-5-benzoyl-6-[(1R)-1,2-dihydroxyethyl]-7,8-dihydroxy-2-(4-methoxyphenyl)imino-6,7,8,8a-tetrahydro-4aH-pyrido[2,3-e][1,3]thiazin-4-one |
|---|---|
| PubChem CID | 139236975 |
| Molecular Formula | C23H25N3O7S |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | (4aS,6R,7R,8S,8aR)-5-benzoyl-6-[(1R)-1,2-dihydroxyethyl]-7,8-dihydroxy-2-(4-methoxyphenyl)imino-6,7,8,8a-tetrahydro-4aH-pyrido[2,3-e][1,3]thiazin-4-one |
| SMILES | COc1ccc(/N=C2/NC(=O)[C@H]3[C@@H](S2)[C@@H](O)[C@H](O)[C@@H]([C@@H](O)CO)N3C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25N3O7S/c1-33-14-9-7-13(8-10-14)24-23-25-21(31)17-20(34-23)19(30)18(29)16(15(28)11-27)26(17)22(32)12-5-3-2-4-6-12/h2-10,15-20,27-30H,11H2,1H3,(H,24,25,31)/t15-,16+,17+,18+,19-,20+/m0/s1 |
| InChIKey | SDRWVKKNHMQMCB-GPBSYSOESA-N |
| XLogP | -0.12 |
| TPSA | 151.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|