C21H15NO3 — CID 136832516
3,4-bis(4-hydroxyphenyl)isoquinolin-7-ol (PubChem CID 136832516) has the molecular formula C21H15NO3 and a molecular weight of 329.36 g/mol. Its IUPAC name is 3,4-bis(4-hydroxyphenyl)isoquinolin-7-ol.
| Compound Name | 3,4-bis(4-hydroxyphenyl)isoquinolin-7-ol |
|---|---|
| PubChem CID | 136832516 |
| Molecular Formula | C21H15NO3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 3,4-bis(4-hydroxyphenyl)isoquinolin-7-ol |
| SMILES | Oc1ccc(-c2ncc3cc(O)ccc3c2-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C21H15NO3/c23-16-5-1-13(2-6-16)20-19-10-9-18(25)11-15(19)12-22-21(20)14-3-7-17(24)8-4-14/h1-12,23-25H |
| InChIKey | RNZABNLJAIMHPH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |