About phenanthridine-1,9-diol
phenanthridine-1,9-diol (PubChem CID 142972562) has the molecular formula C13H9NO2
and a molecular weight of 211.22 g/mol. Its IUPAC name is phenanthridine-1,9-diol.
Molecular Properties
| Compound Name | phenanthridine-1,9-diol |
| PubChem CID | 142972562 |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | phenanthridine-1,9-diol |
| SMILES | Oc1ccc2cnc3cccc(O)c3c2c1 |
| InChI | InChI=1S/C13H9NO2/c15-9-5-4-8-7-14-11-2-1-3-12(16)13(11)10(8)6-9/h1-7,15-16H |
| InChIKey | RMMPQJDOWNUMHC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze phenanthridine-1,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthridine-1,9-diol?
The IUPAC name of phenanthridine-1,9-diol (CID 142972562) is phenanthridine-1,9-diol.
What is the SMILES notation for phenanthridine-1,9-diol?
The canonical SMILES for phenanthridine-1,9-diol is Oc1ccc2cnc3cccc(O)c3c2c1.
What is the InChIKey of phenanthridine-1,9-diol?
The InChIKey is RMMPQJDOWNUMHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO2/c15-9-5-4-8-7-14-11-2-1-3-12(16)13(11)10(8)6-9/h1-7,15-16H.
What are the key properties of phenanthridine-1,9-diol?
phenanthridine-1,9-diol has a molecular weight of 211.22 g/mol, XLogP of 2.80, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthridine-1,9-diol is sourced from PubChem (CID 142972562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).