C44H28N4O4S4 — CID 136834916
5,17-bis(naphthalen-2-yldiazenyl)-2,8,14,20-tetrathiapentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene-25,26,27,28-tetrol (PubChem CID 136834916) has the molecular formula C44H28N4O4S4 and a molecular weight of 805.00 g/mol. Its IUPAC name is 5,17-bis(naphthalen-2-yldiazenyl)-2,8,14,20-tetrathiapentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene-25,26,27,28-tetrol.
| Compound Name | 5,17-bis(naphthalen-2-yldiazenyl)-2,8,14,20-tetrathiapentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene-25,26,27,28-tetrol |
|---|---|
| PubChem CID | 136834916 |
| Molecular Formula | C44H28N4O4S4 |
| Molecular Weight | 805.00 g/mol |
| Exact Mass | 804.10 |
| IUPAC Name | 5,17-bis(naphthalen-2-yldiazenyl)-2,8,14,20-tetrathiapentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaene-25,26,27,28-tetrol |
| SMILES | Oc1c2cccc1Sc1cc(/N=N/c3ccc4ccccc4c3)cc(c1O)Sc1cccc(c1O)Sc1cc(/N=N/c3ccc4ccccc4c3)cc(c1O)S2 |
| InChI | InChI=1S/C44H28N4O4S4/c49-41-33-11-5-13-35(41)55-39-23-32(48-46-30-18-16-26-8-2-4-10-28(26)20-30)24-40(44(39)52)56-36-14-6-12-34(42(36)50)54-38-22-31(21-37(53-33)43(38)51)47-45-29-17-15-25-7-1-3-9-27(25)19-29/h1-24,49-52H/b47-45+,48-46+ |
| InChIKey | GKORCWSPJVOKLK-MLGMXDONSA-N |
| XLogP | 14.56 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.00 |
| LogP ≤ 5 | 14.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|