C14H25N5O2 — CID 136837694
4-[7-(dimethoxymethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]cyclohexan-1-amine (PubChem CID 136837694) has the molecular formula C14H25N5O2 and a molecular weight of 295.39 g/mol. Its IUPAC name is 4-[7-(dimethoxymethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]cyclohexan-1-amine.
| Compound Name | 4-[7-(dimethoxymethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 136837694 |
| Molecular Formula | C14H25N5O2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 4-[7-(dimethoxymethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]cyclohexan-1-amine |
| SMILES | COC(OC)C1CCNc2nc(C3CCC(N)CC3)nn21 |
| InChI | InChI=1S/C14H25N5O2/c1-20-13(21-2)11-7-8-16-14-17-12(18-19(11)14)9-3-5-10(15)6-4-9/h9-11,13H,3-8,15H2,1-2H3,(H,16,17,18) |
| InChIKey | DURRXUCAPXORJY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|