C13H16F3IN2O2 — CID 136842484
4-cyclopentyl-5-iodo-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one (PubChem CID 136842484) has the molecular formula C13H16F3IN2O2 and a molecular weight of 416.18 g/mol. Its IUPAC name is 4-cyclopentyl-5-iodo-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 4-cyclopentyl-5-iodo-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842484 |
| Molecular Formula | C13H16F3IN2O2 |
| Molecular Weight | 416.18 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 4-cyclopentyl-5-iodo-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(CCOCC(F)(F)F)nc(C2CCCC2)c1I |
| InChI | InChI=1S/C13H16F3IN2O2/c14-13(15,16)7-21-6-5-9-18-11(8-3-1-2-4-8)10(17)12(20)19-9/h8H,1-7H2,(H,18,19,20) |
| InChIKey | WZYLGHWBVWHONU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.18 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|