C17H23+ — CID 136862043
2-ethyl-3-[2-(2-ethylcyclopenta-1,3-dien-1-yl)propan-2-yl]cyclopenta-1,3-diene (PubChem CID 136862043) has the molecular formula C17H23+ and a molecular weight of 227.37 g/mol. Its IUPAC name is 2-ethyl-3-[2-(2-ethylcyclopenta-1,3-dien-1-yl)propan-2-yl]cyclopenta-1,3-diene.
| Compound Name | 2-ethyl-3-[2-(2-ethylcyclopenta-1,3-dien-1-yl)propan-2-yl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 136862043 |
| Molecular Formula | C17H23+ |
| Molecular Weight | 227.37 g/mol |
| Exact Mass | 227.18 |
| IUPAC Name | 2-ethyl-3-[2-(2-ethylcyclopenta-1,3-dien-1-yl)propan-2-yl]cyclopenta-1,3-diene |
| SMILES | CCC1=C[CH+]C=C1C(C)(C)C1=C(CC)C=CC1 |
| InChI | InChI=1S/C17H23/c1-5-13-9-7-11-15(13)17(3,4)16-12-8-10-14(16)6-2/h7-11H,5-6,12H2,1-4H3/q+1 |
| InChIKey | WIVACSSEDWGGNU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.37 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|