C16H13BrCl2N4O3 — CID 136863891
N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(3,4-dichlorophenyl)carbamoylamino]acetamide (PubChem CID 136863891) has the molecular formula C16H13BrCl2N4O3 and a molecular weight of 460.12 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(3,4-dichlorophenyl)carbamoylamino]acetamide.
| Compound Name | N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(3,4-dichlorophenyl)carbamoylamino]acetamide |
|---|---|
| PubChem CID | 136863891 |
| Molecular Formula | C16H13BrCl2N4O3 |
| Molecular Weight | 460.12 g/mol |
| Exact Mass | 457.95 |
| IUPAC Name | N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(3,4-dichlorophenyl)carbamoylamino]acetamide |
| SMILES | O=C(CNC(=O)Nc1ccc(Cl)c(Cl)c1)N/N=C\c1cc(Br)ccc1O |
| InChI | InChI=1S/C16H13BrCl2N4O3/c17-10-1-4-14(24)9(5-10)7-21-23-15(25)8-20-16(26)22-11-2-3-12(18)13(19)6-11/h1-7,24H,8H2,(H,23,25)(H2,20,22,26)/b21-7- |
| InChIKey | JOIHMBCOEPTNIS-YXSASFKJSA-N |
| XLogP | 3.73 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.12 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|