C25H26FN7O8 — CID 136871023
(2S)-2-[[4-[[N-[2-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)ethyl]-5-fluoro-2-nitroanilino]methyl]benzoyl]amino]pentanedioic acid (PubChem CID 136871023) has the molecular formula C25H26FN7O8 and a molecular weight of 571.52 g/mol. Its IUPAC name is (2S)-2-[[4-[[N-[2-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)ethyl]-5-fluoro-2-nitroanilino]methyl]benzoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-[[N-[2-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)ethyl]-5-fluoro-2-nitroanilino]methyl]benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 136871023 |
| Molecular Formula | C25H26FN7O8 |
| Molecular Weight | 571.52 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | (2S)-2-[[4-[[N-[2-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)ethyl]-5-fluoro-2-nitroanilino]methyl]benzoyl]amino]pentanedioic acid |
| SMILES | Nc1nc(N)c(CCN(Cc2ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc2)c2cc(F)ccc2[N+](=O)[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C25H26FN7O8/c26-15-5-7-18(33(40)41)19(11-15)32(10-9-16-21(27)30-25(28)31-23(16)37)12-13-1-3-14(4-2-13)22(36)29-17(24(38)39)6-8-20(34)35/h1-5,7,11,17H,6,8-10,12H2,(H,29,36)(H,34,35)(H,38,39)(H5,27,28,30,31,37)/t17-/m0/s1 |
| InChIKey | MUJRWJATMJYLJE-KRWDZBQOSA-N |
| XLogP | 1.28 |
| TPSA | 247.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.52 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|