C21H14N6 — CID 136880511
3-amino-5-[(E)-1-cyano-2-(1H-indol-3-yl)ethenyl]-1-phenylpyrazole-4-carbonitrile (PubChem CID 136880511) has the molecular formula C21H14N6 and a molecular weight of 350.39 g/mol. Its IUPAC name is 3-amino-5-[(E)-1-cyano-2-(1H-indol-3-yl)ethenyl]-1-phenylpyrazole-4-carbonitrile.
| Compound Name | 3-amino-5-[(E)-1-cyano-2-(1H-indol-3-yl)ethenyl]-1-phenylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 136880511 |
| Molecular Formula | C21H14N6 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 3-amino-5-[(E)-1-cyano-2-(1H-indol-3-yl)ethenyl]-1-phenylpyrazole-4-carbonitrile |
| SMILES | N#C/C(=C/c1c[nH]c2ccccc12)c1c(C#N)c(N)nn1-c1ccccc1 |
| InChI | InChI=1S/C21H14N6/c22-11-14(10-15-13-25-19-9-5-4-8-17(15)19)20-18(12-23)21(24)26-27(20)16-6-2-1-3-7-16/h1-10,13,25H,(H2,24,26)/b14-10- |
| InChIKey | XNVCUEHSMGLKPT-UVTDQMKNSA-N |
| XLogP | 3.87 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|