About CID 136881006
CID 136881006 (PubChem CID 136881006) has the molecular formula C16H11F6GeO2
and a molecular weight of 421.86 g/mol.
Molecular Properties
| Compound Name | CID 136881006 |
| PubChem CID | 136881006 |
| Molecular Formula | C16H11F6GeO2 |
| Molecular Weight | 421.86 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | — |
| SMILES | CC(=O)O[Ge](c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H11F6GeO2/c1-10(24)25-23(13-6-2-11(3-7-13)15(17,18)19)14-8-4-12(5-9-14)16(20,21)22/h2-9H,1H3 |
| InChIKey | IDKXLKLYFQYNCD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.86 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 136881006 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136881006?
The IUPAC name of CID 136881006 (CID 136881006) is not available.
What is the SMILES notation for CID 136881006?
The canonical SMILES for CID 136881006 is CC(=O)O[Ge](c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of CID 136881006?
The InChIKey is IDKXLKLYFQYNCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F6GeO2/c1-10(24)25-23(13-6-2-11(3-7-13)15(17,18)19)14-8-4-12(5-9-14)16(20,21)22/h2-9H,1H3.
What are the key properties of CID 136881006?
CID 136881006 has a molecular weight of 421.86 g/mol, XLogP of 3.39, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136881006 is sourced from PubChem (CID 136881006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).