C11H13BrF4N2O2 — CID 136890444
5-bromo-4-propan-2-yl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one (PubChem CID 136890444) has the molecular formula C11H13BrF4N2O2 and a molecular weight of 361.13 g/mol. Its IUPAC name is 5-bromo-4-propan-2-yl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-propan-2-yl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136890444 |
| Molecular Formula | C11H13BrF4N2O2 |
| Molecular Weight | 361.13 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 5-bromo-4-propan-2-yl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
| SMILES | CC(C)c1nc(COCC(F)(F)C(F)F)[nH]c(=O)c1Br |
| InChI | InChI=1S/C11H13BrF4N2O2/c1-5(2)8-7(12)9(19)18-6(17-8)3-20-4-11(15,16)10(13)14/h5,10H,3-4H2,1-2H3,(H,17,18,19) |
| InChIKey | XBYBKTDLKGOXPY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.13 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|