C47H35N7 — CID 136901174
5-(4-hex-1-ynylphenyl)-10,15,20-tripyridin-2-yl-21,23-dihydroporphyrin (PubChem CID 136901174) has the molecular formula C47H35N7 and a molecular weight of 697.85 g/mol. Its IUPAC name is 5-(4-hex-1-ynylphenyl)-10,15,20-tripyridin-2-yl-21,23-dihydroporphyrin.
| Compound Name | 5-(4-hex-1-ynylphenyl)-10,15,20-tripyridin-2-yl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136901174 |
| Molecular Formula | C47H35N7 |
| Molecular Weight | 697.85 g/mol |
| Exact Mass | 697.30 |
| IUPAC Name | 5-(4-hex-1-ynylphenyl)-10,15,20-tripyridin-2-yl-21,23-dihydroporphyrin |
| SMILES | CCCCC#Cc1ccc(-c2c3nc(c(-c4ccccn4)c4ccc([nH]4)c(-c4ccccn4)c4nc(c(-c5ccccn5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C47H35N7/c1-2-3-4-5-12-31-16-18-32(19-17-31)44-36-20-22-38(51-36)45(33-13-6-9-28-48-33)40-24-26-42(53-40)47(35-15-8-11-30-50-35)43-27-25-41(54-43)46(34-14-7-10-29-49-34)39-23-21-37(44)52-39/h6-11,13-30,51,54H,2-4H2,1H3/b44-36-,44-37-,45-38-,45-40-,46-39-,46-41-,47-42-,47-43- |
| InChIKey | JAUCTFJNFWSYDW-ZQANTMHOSA-N |
| XLogP | 11.05 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.85 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|