C60H42N6 — CID 136903413
2-[3-(4-methylphenyl)-1-phenylpyrazol-5-yl]-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin (PubChem CID 136903413) has the molecular formula C60H42N6 and a molecular weight of 847.04 g/mol. Its IUPAC name is 2-[3-(4-methylphenyl)-1-phenylpyrazol-5-yl]-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin.
| Compound Name | 2-[3-(4-methylphenyl)-1-phenylpyrazol-5-yl]-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136903413 |
| Molecular Formula | C60H42N6 |
| Molecular Weight | 847.04 g/mol |
| Exact Mass | 846.35 |
| IUPAC Name | 2-[3-(4-methylphenyl)-1-phenylpyrazol-5-yl]-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin |
| SMILES | Cc1ccc(-c2cc(-c3cc4[nH]c3c(-c3ccccc3)c3nc(c(-c5ccccc5)c5ccc([nH]5)c(-c5ccccc5)c5nc(c4-c4ccccc4)C=C5)C=C3)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C60H42N6/c1-39-27-29-40(30-28-39)53-38-55(66(65-53)45-25-15-6-16-26-45)46-37-54-58(43-21-11-4-12-22-43)51-34-33-49(62-51)56(41-17-7-2-8-18-41)47-31-32-48(61-47)57(42-19-9-3-10-20-42)50-35-36-52(63-50)59(60(46)64-54)44-23-13-5-14-24-44/h2-38,61,64H,1H3/b56-47-,56-49-,57-48-,57-50-,58-51-,58-54-,59-52-,60-59- |
| InChIKey | OOIZUZQREZNFMB-GFFFDAPJSA-N |
| XLogP | 15.15 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.04 |
| LogP ≤ 5 | 15.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |