C54H35N7O4 — CID 136880100
1-(4-nitrophenyl)-5-(5,10,15,20-tetraphenyl-21,23-dihydroporphyrin-2-yl)pyrazole-3-carboxylic acid (PubChem CID 136880100) has the molecular formula C54H35N7O4 and a molecular weight of 845.92 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-5-(5,10,15,20-tetraphenyl-21,23-dihydroporphyrin-2-yl)pyrazole-3-carboxylic acid.
| Compound Name | 1-(4-nitrophenyl)-5-(5,10,15,20-tetraphenyl-21,23-dihydroporphyrin-2-yl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 136880100 |
| Molecular Formula | C54H35N7O4 |
| Molecular Weight | 845.92 g/mol |
| Exact Mass | 845.28 |
| IUPAC Name | 1-(4-nitrophenyl)-5-(5,10,15,20-tetraphenyl-21,23-dihydroporphyrin-2-yl)pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cc3[nH]c2c(-c2ccccc2)c2nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c3-c3ccccc3)C=C4)C=C2)n(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C54H35N7O4/c62-54(63)47-32-48(60(59-47)37-21-23-38(24-22-37)61(64)65)39-31-46-51(35-17-9-3-10-18-35)44-28-27-42(56-44)49(33-13-5-1-6-14-33)40-25-26-41(55-40)50(34-15-7-2-8-16-34)43-29-30-45(57-43)52(53(39)58-46)36-19-11-4-12-20-36/h1-32,55,58H,(H,62,63)/b49-40-,49-42-,50-41-,50-43-,51-44-,51-46-,52-45-,53-52- |
| InChIKey | FQJKQKLJNOXGEN-VJZAWEMCSA-N |
| XLogP | 12.78 |
| TPSA | 155.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.92 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|