C11H17N7 — CID 136905195
N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1-[(6S)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methanamine (PubChem CID 136905195) has the molecular formula C11H17N7 and a molecular weight of 247.31 g/mol. Its IUPAC name is N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1-[(6S)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methanamine.
| Compound Name | N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1-[(6S)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methanamine |
|---|---|
| PubChem CID | 136905195 |
| Molecular Formula | C11H17N7 |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1-[(6S)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methanamine |
| SMILES | Cn1cnnc1CNC[C@H]1CNc2ccnn2C1 |
| InChI | InChI=1S/C11H17N7/c1-17-8-14-16-11(17)6-12-4-9-5-13-10-2-3-15-18(10)7-9/h2-3,8-9,12-13H,4-7H2,1H3/t9-/m0/s1 |
| InChIKey | YVWXRMVUGUZNLH-VIFPVBQESA-N |
| XLogP | -0.16 |
| TPSA | 72.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |