C16H20FN5O — CID 154775783
2-fluoro-N-[2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-ylmethylamino)ethyl]benzamide (PubChem CID 154775783) has the molecular formula C16H20FN5O and a molecular weight of 317.37 g/mol. Its IUPAC name is 2-fluoro-N-[2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-ylmethylamino)ethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-ylmethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 154775783 |
| Molecular Formula | C16H20FN5O |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2-fluoro-N-[2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-ylmethylamino)ethyl]benzamide |
| SMILES | O=C(NCCNCC1CNc2ccnn2C1)c1ccccc1F |
| InChI | InChI=1S/C16H20FN5O/c17-14-4-2-1-3-13(14)16(23)19-8-7-18-9-12-10-20-15-5-6-21-22(15)11-12/h1-6,12,18,20H,7-11H2,(H,19,23) |
| InChIKey | SIVZOYBINNCZMP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|