C21H16N2O3 — CID 136913689
3-[(5-hydroxy-2-phenyl-1,3-oxazol-4-yl)methylidene]-7,8-dimethylquinolin-2-one (PubChem CID 136913689) has the molecular formula C21H16N2O3 and a molecular weight of 344.37 g/mol. Its IUPAC name is 3-[(5-hydroxy-2-phenyl-1,3-oxazol-4-yl)methylidene]-7,8-dimethylquinolin-2-one.
| Compound Name | 3-[(5-hydroxy-2-phenyl-1,3-oxazol-4-yl)methylidene]-7,8-dimethylquinolin-2-one |
|---|---|
| PubChem CID | 136913689 |
| Molecular Formula | C21H16N2O3 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 3-[(5-hydroxy-2-phenyl-1,3-oxazol-4-yl)methylidene]-7,8-dimethylquinolin-2-one |
| SMILES | Cc1ccc2c(c1C)=NC(=O)C(=Cc1nc(-c3ccccc3)oc1O)C=2 |
| InChI | InChI=1S/C21H16N2O3/c1-12-8-9-15-10-16(19(24)23-18(15)13(12)2)11-17-21(25)26-20(22-17)14-6-4-3-5-7-14/h3-11,25H,1-2H3 |
| InChIKey | RAHMWUKEQIMBOT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|