C10H12N4OS — CID 136922606
3-piperidin-4-yl-5H-[1,2]thiazolo[5,4-d]pyrimidin-4-one (PubChem CID 136922606) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is 3-piperidin-4-yl-5H-[1,2]thiazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 3-piperidin-4-yl-5H-[1,2]thiazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136922606 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 3-piperidin-4-yl-5H-[1,2]thiazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2snc(C3CCNCC3)c12 |
| InChI | InChI=1S/C10H12N4OS/c15-9-7-8(6-1-3-11-4-2-6)14-16-10(7)13-5-12-9/h5-6,11H,1-4H2,(H,12,13,15) |
| InChIKey | LCNHPTVFTOLFOI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |