C15H23N5O4 — CID 136927179
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-imino-1-(3-methylbut-2-enyl)-2,3-dihydropurin-9-yl]oxolane-3,4-diol (PubChem CID 136927179) has the molecular formula C15H23N5O4 and a molecular weight of 337.38 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-imino-1-(3-methylbut-2-enyl)-2,3-dihydropurin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-imino-1-(3-methylbut-2-enyl)-2,3-dihydropurin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 136927179 |
| Molecular Formula | C15H23N5O4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-imino-1-(3-methylbut-2-enyl)-2,3-dihydropurin-9-yl]oxolane-3,4-diol |
| SMILES | [H]/N=C1/c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2NCN1CC=C(C)C |
| InChI | InChI=1S/C15H23N5O4/c1-8(2)3-4-19-6-18-14-10(13(19)16)17-7-20(14)15-12(23)11(22)9(5-21)24-15/h3,7,9,11-12,15-16,18,21-23H,4-6H2,1-2H3/b16-13-/t9-,11-,12-,15-/m1/s1 |
| InChIKey | DOWYLOFMUCOIQQ-AMWIWQRDSA-N |
| XLogP | -0.53 |
| TPSA | 126.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|