C10H13N5O4 — CID 135506513
(2R,3S,4S,5R)-2-(hydroxymethyl)-5-(6-imino-7H-purin-1-yl)oxolane-3,4-diol (PubChem CID 135506513) has the molecular formula C10H13N5O4 and a molecular weight of 267.25 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(hydroxymethyl)-5-(6-imino-7H-purin-1-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-5-(6-imino-7H-purin-1-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 135506513 |
| Molecular Formula | C10H13N5O4 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-5-(6-imino-7H-purin-1-yl)oxolane-3,4-diol |
| SMILES | [H]/N=c1\c2[nH]cnc2ncn1[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H13N5O4/c11-8-5-9(13-2-12-5)14-3-15(8)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10-11,16-18H,1H2,(H,12,13)/b11-8+/t4-,6-,7+,10-/m1/s1 |
| InChIKey | OWYCXGBEFYXXKJ-CUZJWGBYSA-N |
| XLogP | -2.15 |
| TPSA | 140.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |