C12H15N5O3 — CID 136715706
[(3R,3aR,5R,6aR)-5-(6-imino-7H-purin-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methanol (PubChem CID 136715706) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is [(3R,3aR,5R,6aR)-5-(6-imino-7H-purin-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methanol.
| Compound Name | [(3R,3aR,5R,6aR)-5-(6-imino-7H-purin-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methanol |
|---|---|
| PubChem CID | 136715706 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | [(3R,3aR,5R,6aR)-5-(6-imino-7H-purin-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methanol |
| SMILES | [H]/N=c1\c2[nH]cnc2ncn1[C@H]1C[C@H]2OC[C@@H](CO)[C@H]2O1 |
| InChI | InChI=1S/C12H15N5O3/c13-11-9-12(15-4-14-9)16-5-17(11)8-1-7-10(20-8)6(2-18)3-19-7/h4-8,10,13,18H,1-3H2,(H,14,15)/b13-11+/t6-,7-,8-,10-/m1/s1 |
| InChIKey | SJCOQWOMCGWUSD-DCAIHRGBSA-N |
| XLogP | -0.47 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |