C8H12N6O — CID 141391153
3-(1-amino-6-imino-7H-purin-2-yl)propan-1-ol (PubChem CID 141391153) has the molecular formula C8H12N6O and a molecular weight of 208.22 g/mol. Its IUPAC name is 3-(1-amino-6-imino-7H-purin-2-yl)propan-1-ol.
| Compound Name | 3-(1-amino-6-imino-7H-purin-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 141391153 |
| Molecular Formula | C8H12N6O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 3-(1-amino-6-imino-7H-purin-2-yl)propan-1-ol |
| SMILES | [H]/N=c1\c2[nH]cnc2nc(CCCO)n1N |
| InChI | InChI=1S/C8H12N6O/c9-7-6-8(12-4-11-6)13-5(14(7)10)2-1-3-15/h4,9,15H,1-3,10H2,(H,11,12)/b9-7+ |
| InChIKey | BYIYUAZUDGLNNM-VQHVLOKHSA-N |
| XLogP | -1.12 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |