C8H9N5O3 — CID 136704244
2-hydroxy-3-(6-imino-7H-purin-1-yl)propanoic acid (PubChem CID 136704244) has the molecular formula C8H9N5O3 and a molecular weight of 223.19 g/mol. Its IUPAC name is 2-hydroxy-3-(6-imino-7H-purin-1-yl)propanoic acid.
| Compound Name | 2-hydroxy-3-(6-imino-7H-purin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 136704244 |
| Molecular Formula | C8H9N5O3 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 2-hydroxy-3-(6-imino-7H-purin-1-yl)propanoic acid |
| SMILES | [H]/N=c1/c2[nH]cnc2ncn1CC(O)C(=O)O |
| InChI | InChI=1S/C8H9N5O3/c9-6-5-7(11-2-10-5)12-3-13(6)1-4(14)8(15)16/h2-4,9,14H,1H2,(H,10,11)(H,15,16)/b9-6- |
| InChIKey | ZAVOQPAISMNFCD-TWGQIWQCSA-N |
| XLogP | -1.32 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |