C10H14N6O2 — CID 136675495
(3S,4R,6R)-4-amino-6-(6-imino-7H-purin-1-yl)oxan-3-ol (PubChem CID 136675495) has the molecular formula C10H14N6O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is (3S,4R,6R)-4-amino-6-(6-imino-7H-purin-1-yl)oxan-3-ol.
| Compound Name | (3S,4R,6R)-4-amino-6-(6-imino-7H-purin-1-yl)oxan-3-ol |
|---|---|
| PubChem CID | 136675495 |
| Molecular Formula | C10H14N6O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (3S,4R,6R)-4-amino-6-(6-imino-7H-purin-1-yl)oxan-3-ol |
| SMILES | [H]/N=c1\c2[nH]cnc2ncn1[C@H]1C[C@@H](N)[C@H](O)CO1 |
| InChI | InChI=1S/C10H14N6O2/c11-5-1-7(18-2-6(5)17)16-4-15-10-8(9(16)12)13-3-14-10/h3-7,12,17H,1-2,11H2,(H,13,14)/b12-9+/t5-,6-,7-/m1/s1 |
| InChIKey | QQFOGQHAVQMREN-YGGOLVSHSA-N |
| XLogP | -1.15 |
| TPSA | 125.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |