C11H13N5O2 — CID 135856465
[(2S,6S)-2-(6-imino-7H-purin-1-yl)-3,6-dihydro-2H-pyran-6-yl]methanol (PubChem CID 135856465) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is [(2S,6S)-2-(6-imino-7H-purin-1-yl)-3,6-dihydro-2H-pyran-6-yl]methanol.
| Compound Name | [(2S,6S)-2-(6-imino-7H-purin-1-yl)-3,6-dihydro-2H-pyran-6-yl]methanol |
|---|---|
| PubChem CID | 135856465 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | [(2S,6S)-2-(6-imino-7H-purin-1-yl)-3,6-dihydro-2H-pyran-6-yl]methanol |
| SMILES | [H]/N=c1\c2[nH]cnc2ncn1[C@@H]1CC=C[C@@H](CO)O1 |
| InChI | InChI=1S/C11H13N5O2/c12-10-9-11(14-5-13-9)15-6-16(10)8-3-1-2-7(4-17)18-8/h1-2,5-8,12,17H,3-4H2,(H,13,14)/b12-10+/t7-,8-/m0/s1 |
| InChIKey | MKSSYFNIJMLTMJ-JOFOEMQUSA-N |
| XLogP | 0.07 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|