C17H18N8O4S2 — CID 3304095
9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-[2-(7H-purin-6-ylsulfanyl)ethyl]purine-6-thione (PubChem CID 3304095) has the molecular formula C17H18N8O4S2 and a molecular weight of 462.52 g/mol. Its IUPAC name is 9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-[2-(7H-purin-6-ylsulfanyl)ethyl]purine-6-thione.
| Compound Name | 9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-[2-(7H-purin-6-ylsulfanyl)ethyl]purine-6-thione |
|---|---|
| PubChem CID | 3304095 |
| Molecular Formula | C17H18N8O4S2 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-[2-(7H-purin-6-ylsulfanyl)ethyl]purine-6-thione |
| SMILES | OCC1OC(n2cnc3c(=S)n(CCSc4ncnc5nc[nH]c45)cnc32)C(O)C1O |
| InChI | InChI=1S/C17H18N8O4S2/c26-3-8-11(27)12(28)16(29-8)25-7-22-10-14(25)23-6-24(17(10)30)1-2-31-15-9-13(19-4-18-9)20-5-21-15/h4-8,11-12,16,26-28H,1-3H2,(H,18,19,20,21) |
| InChIKey | IVDOAYYTCCRBPI-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 160.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|