C23H26N4O3S — CID 136939940
6-(3,4-dihydroxyphenyl)-3-heptylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 136939940) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is 6-(3,4-dihydroxyphenyl)-3-heptylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | 6-(3,4-dihydroxyphenyl)-3-heptylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 136939940 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 6-(3,4-dihydroxyphenyl)-3-heptylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCCCCSC1=NN2C(=c3ccccc3=NC2c2ccc(O)c(O)c2)C(=O)N1 |
| InChI | InChI=1S/C23H26N4O3S/c1-2-3-4-5-8-13-31-23-25-22(30)20-16-9-6-7-10-17(16)24-21(27(20)26-23)15-11-12-18(28)19(29)14-15/h6-7,9-12,14,21,28-29H,2-5,8,13H2,1H3,(H,25,26,30) |
| InChIKey | BHDKIXSCTCCSIS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|